Online Database of Chemicals from Around the World
|
CAS#: 15951-99-2 Product: (1R,2S)-1,2-Dichloro-1,2-Diphenylethane No suppilers available for the product. |
| Name | (1R,2S)-1,2-Dichloro-1,2-Diphenylethane |
|---|---|
| Synonyms | (1,2-Dichloro-2-Phenyl-Ethyl)Benzene; Nsc39786; Nsc245147 |
| Molecular Structure |  |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.15 |
| CAS Registry Number | 15951-99-2 (5963-49-5) |
| SMILES | C1=CC=CC=C1C(C(C2=CC=CC=C2)Cl)Cl |
| InChI | 1S/C14H12Cl2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | FJEFRYPSCFFXEX-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.668°C at 760 mmHg (Cal.) |
| Flash point | 163.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-1,2-Dichloro-1,2-Diphenylethane |