| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 7-{[(2E)-3-Iodo-2-Propen-1-Yl](Propyl)Amino}-5,6,7,8-Tetrahydro-2-Naphthalenol (2Z)-2-Butenedioate (1:1) |
|---|---|
| Synonyms | (RS)-tran |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26INO5 |
| Molecular Weight | 487.33 |
| CAS Registry Number | 159559-71-4 |
| SMILES | CCCN(C/C=C/I)C1CCC2=C(C1)C=C(C=C2)O.C(=C\C(=O)O)\C(=O)O |
| InChI | 1S/C16H22INO.C4H4O4/c1-2-9-18(10-3-8-17)15-6-4-13-5-7-16(19)12-14(13)11-15;5-3(6)1-2-4(7)8/h3,5,7-8,12,15,19H,2,4,6,9-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b8-3+;2-1- |
| InChIKey | IQRDHLSQXOATHD-HBRCEPSSSA-N |
| Refractive index | (Cal.) |
|---|---|
| solubility | Soluble to 50 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 7-{[(2E)-3-Iodo-2-Propen-1-Yl](Propyl)Amino}-5,6,7,8-Tetrahydro-2-Naphthalenol (2Z)-2-Butenedioate (1:1) |