| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | rac-BINAP Pd G4 |
| Synonyms | (SP-4-3)-[[2'-(Diphenylphosphino)[1,1'-binaphthalen]-2-yl]diphenylphosphine-?P](methanesulfonato-?O)[2'-(methylamino-?N)[1,1'-biphenyl]-2-yl-?C]palladium |
| Molecular Structure | ![]() |
| Molecular Formula | C58H47NO3P2PdS |
| Molecular Weight | 1006.43 |
| CAS Registry Number | 1599466-90-6 |
| SMILES | C[NH+]1c2ccccc2-c3ccccc3[Pd-]1OS(=O)(=O)C.c1ccc(cc1)P(c2ccccc2)c3ccc4ccccc4c3c5c6ccccc6ccc5P(c7ccccc7)c8ccccc8 |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
|
Rac-BINAP Pd G4 is an advanced palladium complex distinguished by its use in asymmetric catalysis. The "BINAP" ligand in this compound stands for 2,2'-bis(diphenylphosphino)-1,1'-binaphthyl, and "rac" indicates that it is a racemic mixture of this chiral ligand. The "G4" designation denotes that this is the fourth generation of the rac-BINAP system, reflecting its evolution and optimization. The BINAP ligand, which is a bidentate phosphine with a binaphthyl backbone, is known for its ability to create highly effective chiral environments around a metal center. This ligand's chirality is crucial for asymmetric synthesis, where controlling the stereochemistry of a reaction is essential. The racemic version of BINAP in rac-BINAP Pd G4 means that it contains both enantiomers of the ligand, which are typically used to provide a balanced performance in various catalytic processes. The discovery of rac-BINAP Pd G4 builds upon the success of earlier generations of BINAP-based palladium complexes. The primary advantage of this system is its ability to facilitate highly selective and efficient asymmetric transformations. The palladium center, coordinated by the BINAP ligand, benefits from enhanced stability and reactivity, making it suitable for a wide range of catalytic reactions. One of the key applications of rac-BINAP Pd G4 is in asymmetric hydrogenation, where it catalyzes the selective addition of hydrogen to unsaturated substrates, producing chiral products with high enantiomeric purity. This reaction is crucial in the synthesis of pharmaceuticals and other fine chemicals, where precise control over stereochemistry is necessary. In addition to asymmetric hydrogenation, rac-BINAP Pd G4 is used in other asymmetric transformations, including asymmetric allylic substitutions and asymmetric oxidative additions. Its ability to create a chiral environment around the palladium center allows for precise control over the formation of chiral centers in complex molecules. The development of rac-BINAP Pd G4 represents a significant advancement in the field of asymmetric catalysis. By optimizing the ligand environment and improving the performance of palladium complexes, researchers have achieved higher levels of selectivity and efficiency in asymmetric synthesis. This has broad implications for the synthesis of chiral compounds in pharmaceuticals, agrochemicals, and materials science. In summary, rac-BINAP Pd G4 is a highly effective palladium complex used in asymmetric catalysis. Its advanced BINAP ligand system enhances catalytic performance, making it a valuable tool for achieving precise control over stereochemistry in a variety of chemical reactions. References none |
| Market Analysis Reports |