Online Database of Chemicals from Around the World
|
CAS#: 160169-49-3 Product: (1R,2S,8aR)-1,2-Dihydroxyhexahydro-3(2H)-Indolizinone No suppilers available for the product. |
| Name | (1R,2S,8aR)-1,2-Dihydroxyhexahydro-3(2H)-Indolizinone |
|---|---|
| Synonyms | 3-Oxo-(-)-lentiginosine |
| Molecular Structure |  |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.19 |
| CAS Registry Number | 160169-49-3 |
| SMILES | O=C1N2[C@@H]([C@@H](O)[C@@H]1O)CCCC2 |
| InChI | 1S/C8H13NO3/c10-6-5-3-1-2-4-9(5)8(12)7(6)11/h5-7,10-11H,1-4H2/t5-,6-,7+/m1/s1 |
| InChIKey | LKCBJKFYFVBJCS-QYNIQEEDSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.719°C at 760 mmHg (Cal.) |
| Flash point | 170.143°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S,8aR)-1,2-Dihydroxyhexahydro-3(2H)-Indolizinone |