Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (301) 961-1525 | |||
|
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 1,5-Dimethoxy-2-Methyl-3-Nitrobenzene |
|---|---|
| Synonyms | 1,5-dimethoxy-2-methyl-3-nitrobenzene; 2,4-DIMETHOXY-6-NITROTOLUENE |
| Molecular Structure |  |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 16024-31-0 |
| SMILES | CC1=C(C=C(C=C1OC)OC)[N+](=O)[O-] |
| InChI | 1S/C9H11NO4/c1-6-8(10(11)12)4-7(13-2)5-9(6)14-3/h4-5H,1-3H3 |
| InChIKey | GNWAEXWMLARGIG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 90-100°C (Expl.) |
| Boiling point | 320.4±37.0°C at 760 mmHg (Cal.) |
| Flash point | 149.1±28.5°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethoxy-2-Methyl-3-Nitrobenzene |