Online Database of Chemicals from Around the World
|
CAS#: 16032-83-0 Product: 5-Hydroxydopa No suppilers available for the product. |
| Name | 5-Hydroxydopa |
|---|---|
| Synonyms | (2S)-2-Amino-3-(3,4,5-Trihydroxyphenyl)Propionic Acid; 3,4,5-Topa; 3,4,5-Trihydroxyphenylalanine |
| Molecular Structure |  |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 16032-83-0 |
| SMILES | [C@H](N)(CC1=CC(=C(O)C(=C1)O)O)C(=O)O |
| InChI | 1S/C9H11NO5/c10-5(9(14)15)1-4-2-6(11)8(13)7(12)3-4/h2-3,5,11-13H,1,10H2,(H,14,15)/t5-/m0/s1 |
| InChIKey | KQZQZOQFUQXPLW-YFKPBYRVSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.743°C at 760 mmHg (Cal.) |
| Flash point | 270.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxydopa |