Online Database of Chemicals from Around the World
|
CAS#: 160543-12-4 Product: 7,9-Dimethylbenz(c)Acridine-5,6-Oxide No suppilers available for the product. |
| Name | 7,9-Dimethylbenz(c)Acridine-5,6-Oxide |
|---|---|
| Synonyms | Ccris 7377 |
| Molecular Structure |  |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 |
| CAS Registry Number | 160543-12-4 |
| SMILES | C2=CC(=CC3=C(C1=C5C(=C4C(=C1N=C23)C=CC=C4)O5)C)C |
| InChI | 1S/C19H13NO/c1-10-7-8-15-14(9-10)11(2)16-17(20-15)12-5-3-4-6-13(12)18-19(16)21-18/h3-9H,1-2H3 |
| InChIKey | KUIHHDYKZJMFDF-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.589°C at 760 mmHg (Cal.) |
| Flash point | 176.728°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,9-Dimethylbenz(c)Acridine-5,6-Oxide |