Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dimethylcyclopenta[b]Pyrrole-4,6(1H,5H)-Dione |
|---|---|
| Synonyms | 2,3-dimethylcyclopenta[b]pyrrole-4,6(1H,5H)-dione |
| Molecular Structure | ![CAS#: 160627-05-4， 2,3-Dimethylcyclopenta[b]Pyrrole-4,6(1H,5H)-Dione](/moreStructures/160627-05-4.gif) |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 160627-05-4 |
| SMILES | Cc1c([nH]c2c1C(=O)CC2=O)C |
| InChI | 1S/C9H9NO2/c1-4-5(2)10-9-7(12)3-6(11)8(4)9/h10H,3H2,1-2H3 |
| InChIKey | JMKQZZHGDWXRQB-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.3°C at 760 mmHg (Cal.) |
| Flash point | 202.81°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethylcyclopenta[b]Pyrrole-4,6(1H,5H)-Dione |