Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | cis-2-Vinyl-1,3-Dioxolane-4-Methanol |
|---|---|
| Synonyms | [(2R,4S)-2-Vinyl-1,3-Dioxolan-4-Yl]Methanol; Cis-2-Vinyl-1,3-Dioxolane-4-Methanol |
| Molecular Structure |  |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 |
| CAS Registry Number | 16081-26-8 |
| EINECS | 240-231-6 |
| SMILES | [C@@H]1(O[C@H](CO1)CO)C=C |
| InChI | 1S/C6H10O3/c1-2-6-8-4-5(3-7)9-6/h2,5-7H,1,3-4H2/t5-,6+/m0/s1 |
| InChIKey | JMAUXGPDSZGZAJ-NTSWFWBYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 184.604°C at 760 mmHg (Cal.) |
| Flash point | 82.376°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-2-Vinyl-1,3-Dioxolane-4-Methanol |