| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomole Scientific Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| IRIS Biotech GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (9231) 961-973 | |||
![]() |
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Amino alcohol derivative |
|---|---|
| Name | (2R,3R)-2-Amino-3-(Benzyloxy)-1-Butanol |
| Synonyms | (2R,3R)-2-AMINO-3-PHENYLMETHOXY-1-BUTANOL; h-Threoninol(bzl); MFCD00235947 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 |
| CAS Registry Number | 160841-03-2 |
| SMILES | OC[C@@H](N)[C@@H](C)OCc1ccccc1 |
| InChI | 1S/C11H17NO2/c1-9(11(12)7-13)14-8-10-5-3-2-4-6-10/h2-6,9,11,13H,7-8,12H2,1H3/t9-,11-/m1/s1 |
| InChIKey | GFXVOWGFPSJLNW-MWLCHTKSSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.226°C at 760 mmHg (Cal.) |
| Flash point | 162.587°C (Cal.) |
| Refractive index | 1.539 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-2-Amino-3-(Benzyloxy)-1-Butanol |