| Suzhou Howsine Biological Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.howsine.com | |||
![]() | +86 (512) 6726-2751 | |||
![]() | +86 (512) 6726-2757 | |||
![]() | sales@howsine.com 1500209357@qq.com | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2008 | ||||
| Zhengzhou Alfachem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.alfachemch.com | |||
![]() | +86 (0371) 5505-2911 | |||
![]() | alfa5@alfachem.cn | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Ketones |
|---|---|
| Name | 4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone |
| Synonyms | 2,9-dibromo-6,13-bis(2-butyloctyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| Molecular Structure | ![]() |
| Molecular Formula | C38H52Br2N2O4 |
| Molecular Weight | 760.64 |
| CAS Registry Number | 1614253-96-1 |
| SMILES | CCCCCCC(CCCC)CN1C(=O)C2=CC(=C3C4=C2C(=C(C=C4C(=O)N(C3=O)CC(CCCC)CCCCCC)Br)C1=O)Br |
| Solubility | Insoluble (5.9E-7 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.293±0.06 g/cm3, Calc.* |
| Index of Refraction | 1.572, Calc.* |
| Boiling Point | 767.4±60.0 °C (760 mmHg), Calc.* |
| Flash Point | 417.9±32.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is a complex organic compound that has attracted attention in the fields of materials science and organic electronics due to its unique structure and potential applications in advanced optoelectronic devices. The discovery of this compound stems from research into novel materials with enhanced electronic properties, particularly those with potential for use in light-emitting devices, solar cells, and sensors. The chemical structure of 4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is composed of a phenanthroline backbone, which is modified with various substituents, including bromine atoms and butyloctyl groups. The presence of bromine atoms allows for the introduction of halogen bonding, which can affect the compound’s electronic and photophysical properties. The butyloctyl groups enhance solubility and processability, which are essential for incorporating this compound into device structures. The primary application of this compound is in organic electronics, where its photophysical and electronic properties make it an ideal candidate for use in organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and organic field-effect transistors (OFETs). The presence of both electron-rich and electron-deficient groups within its structure contributes to the ability of the compound to absorb light efficiently and transport charge carriers, which is crucial for the performance of optoelectronic devices. Additionally, the compound’s solubility properties allow for easy processing in solution-based methods, which is a key advantage in the fabrication of flexible and lightweight electronic devices. In OLEDs, this compound can serve as a light-emitting material due to its ability to emit light when subjected to an electric current. Its unique structure allows for high efficiency in light emission and stability, making it an attractive candidate for use in displays, lighting, and other optical applications. In OPVs, the compound can act as a donor or acceptor material in the active layer, where it facilitates the conversion of solar energy into electrical energy, contributing to the development of more efficient and affordable solar cell technologies. Moreover, 4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is also being explored for use in sensors and other electronic devices that require high-performance materials with tailored electronic properties. The compound’s ability to interact with light and charge carriers makes it a valuable component in the development of innovative sensor technologies for environmental monitoring and detection systems. The discovery and development of 4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone represent important advances in the field of organic electronics, offering a versatile material for the next generation of optoelectronic devices. Its combination of solubility, photophysical properties, and charge transport capabilities makes it a promising candidate for a variety of applications that could impact energy efficiency, environmental sustainability, and advanced electronics. References none |
| Market Analysis Reports |
| List of Reports Available for 4,9-Dibromo-2,7-bis(2-butyloctyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone |