|
CAS#: 161532-19-0 Product: Methyl 4-Methoxy-1H-Indole-3-Carboxylate No suppilers available for the product. |
| Name | Methyl 4-Methoxy-1H-Indole-3-Carboxylate |
|---|---|
| Synonyms | Methyl 4-methoxyindole-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 |
| CAS Registry Number | 161532-19-0 |
| SMILES | COc1cccc2c1c(c[nH]2)C(=O)OC |
| InChI | 1S/C11H11NO3/c1-14-9-5-3-4-8-10(9)7(6-12-8)11(13)15-2/h3-6,12H,1-2H3 |
| InChIKey | QPCLDGGSAWJMAB-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.062°C at 760 mmHg (Cal.) |
| Flash point | 177.608°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Methoxy-1H-Indole-3-Carboxylate |