Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Ethylquinoxaline 1-Oxide |
|---|---|
| Synonyms | 3-Ethylquinoxaline 1-oxide # |
| Molecular Structure |  |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 |
| CAS Registry Number | 16154-83-9 |
| SMILES | [O-][n+]1c2ccccc2nc(c1)CC |
| InChI | 1S/C10H10N2O/c1-2-8-7-12(13)10-6-4-3-5-9(10)11-8/h3-7H,2H2,1H3 |
| InChIKey | OWWYRFQLKQAGAE-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.478°C at 760 mmHg (Cal.) |
| Flash point | 144.596°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethylquinoxaline 1-Oxide |