Online Database of Chemicals from Around the World
|
CAS#: 16169-17-8 Product: N-Hydroxy-(1,1'-Biphenyl)-2-Amine No suppilers available for the product. |
| Name | N-Hydroxy-(1,1'-Biphenyl)-2-Amine |
|---|---|
| Synonyms | (1,1'-Biphenyl)-2-Amine, N-Hydroxy-; Brn 2691720; Ccris 2821 |
| Molecular Structure |  |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 |
| CAS Registry Number | 16169-17-8 |
| SMILES | C1=C(C(=CC=C1)C2=CC=CC=C2)NO |
| InChI | 1S/C12H11NO/c14-13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13-14H |
| InChIKey | HVHPNXLNQJYDMK-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.802°C at 760 mmHg (Cal.) |
| Flash point | 158.651°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Hydroxy-(1,1'-Biphenyl)-2-Amine |