Online Database of Chemicals from Around the World
|
CAS#: 1621-32-5 Product: Ethyl 1-(P-Methylbenzyl)Cyclopropanecarboxylate No suppilers available for the product. |
| Name | Ethyl 1-(P-Methylbenzyl)Cyclopropanecarboxylate |
|---|---|
| Synonyms | 1-[(4-Methylphenyl)Methyl]-1-Cyclopropanecarboxylic Acid Ethyl Ester; 1-(4-Methylbenzyl)Cyclopropane-1-Carboxylic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 1621-32-5 |
| EINECS | 216-593-6 |
| SMILES | C2=C(CC1(C(=O)OCC)CC1)C=CC(=C2)C |
| InChI | 1S/C14H18O2/c1-3-16-13(15)14(8-9-14)10-12-6-4-11(2)5-7-12/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | CMPPICYVULJWRY-UHFFFAOYSA-N |
| Density | 1.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.098°C at 760 mmHg (Cal.) |
| Flash point | 124.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-(P-Methylbenzyl)Cyclopropanecarboxylate |