Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | Ethyl 4-(2-Chlorophenyl)-2-Methyl-5-Pyrimidinecarboxylate |
|---|---|
| Synonyms | Ethyl-2-methyl-4-(2-chlorophenyl)-5-pyrimidine carboxylate; ETHYL-2-METHYL-4-(2-CHLOROPHENYL)-5-PYRIMIDINECARBOXYLATE |
| Molecular Structure |  |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 |
| CAS Registry Number | 162509-17-3 |
| SMILES | Cc2nc(c1ccccc1Cl)c(cn2)C(=O)OCC |
| InChI | 1S/C14H13ClN2O2/c1-3-19-14(18)11-8-16-9(2)17-13(11)10-6-4-5-7-12(10)15/h4-8H,3H2,1-2H3 |
| InChIKey | BLSMKNPQEOCGOZ-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.512°C at 760 mmHg (Cal.) |
| Flash point | 196.023°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(2-Chlorophenyl)-2-Methyl-5-Pyrimidinecarboxylate |