Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1,3,3,5,5-Hexamethyl-1,3,5-Trisilacyclohexane |
|---|---|
| Synonyms | 1,1,3,3,5,5-Hexamethyl-1,3,5-Trisilacyclohexane; 1,1,3,3,5,5-Hexamethylcyclotrimethylenetrisilane; 1,3,5-Trisilacyclohexane, 1,1,3,3,5,5-Hexamethyl- |
| Molecular Structure |  |
| Molecular Formula | C9H24Si3 |
| Molecular Weight | 216.55 |
| CAS Registry Number | 1627-99-2 |
| SMILES | C[Si]1(C[Si](C[Si](C1)(C)C)(C)C)C |
| InChI | 1S/C9H24Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H2,1-6H3 |
| InChIKey | ICSWLKDKQBNKAY-UHFFFAOYSA-N |
| Density | 0.815g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.276°C at 760 mmHg (Cal.) |
| Flash point | 59.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3,5,5-Hexamethyl-1,3,5-Trisilacyclohexane |