Online Database of Chemicals from Around the World
|
CAS#: 16277-49-9 Product: 4-Methoxy-7,12-Dimethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 4-Methoxy-7,12-Dimethylbenz(a)Anthracene |
|---|---|
| Synonyms | 4-Methoxy-7,12-Dimethyl-Benzo[A]Anthracene; 4-Methoxy-7,12-Dimethylbenz(A)Anthracene; 4-Methoxy-Dmba |
| Molecular Structure |  |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 |
| CAS Registry Number | 16277-49-9 |
| SMILES | C1=CC3=C(C2=CC=CC(=C12)OC)C(=C4C(=C3C)C=CC=C4)C |
| InChI | 1S/C21H18O/c1-13-15-7-4-5-8-16(15)14(2)21-17(13)11-12-18-19(21)9-6-10-20(18)22-3/h4-12H,1-3H3 |
| InChIKey | LJLLJQAPUIVZJF-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.93°C at 760 mmHg (Cal.) |
| Flash point | 204.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-7,12-Dimethylbenz(a)Anthracene |