Online Database of Chemicals from Around the World
|
CAS#: 1629-19-2 Product: 4-Fluoro-N-Phenyl-Benzenecarbothioamide No suppilers available for the product. |
| Name | 4-Fluoro-N-Phenyl-Benzenecarbothioamide |
|---|---|
| Synonyms | 4-Fluoro-N-Phenyl-Benzenecarbothioamide; 4-Fluoro-N-Phenyl-Thiobenzamide; Nsc51896 |
| Molecular Structure |  |
| Molecular Formula | C13H10FNS |
| Molecular Weight | 231.29 |
| CAS Registry Number | 1629-19-2 |
| SMILES | C1=CC=CC=C1NC(C2=CC=C(F)C=C2)=S |
| InChI | 1S/C13H10FNS/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
| InChIKey | LQKYDGGOSBFZDI-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.646°C at 760 mmHg (Cal.) |
| Flash point | 151.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoro-N-Phenyl-Benzenecarbothioamide |