Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-2,2,2-Trifluoroethanone |
|---|---|
| Synonyms | (R)-1-(2, |
| Molecular Structure | ![CAS#: 162932-23-2， 1-[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-2,2,2-Trifluoroethanone](/moreStructures/162932-23-2.gif) |
| Molecular Formula | C7H9F3O3 |
| Molecular Weight | 198.14 |
| CAS Registry Number | 162932-23-2 |
| SMILES | CC1(OC[C@@H](O1)C(=O)C(F)(F)F)C |
| InChI | 1S/C7H9F3O3/c1-6(2)12-3-4(13-6)5(11)7(8,9)10/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | GZMLZAFJGLIJDA-SCSAIBSYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 169.89°C at 760 mmHg (Cal.) |
| Flash point | 55.532°C (Cal.) |
| Refractive index | 1.376 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(4R)-2,2-Dimethyl-1,3-Dioxolan-4-Yl]-2,2,2-Trifluoroethanone |