Online Database of Chemicals from Around the World
|
CAS#: 16310-69-3 Product: 1,2,3,4,8,9-Hexahydrodibenz[a,h]Anthracene No suppilers available for the product. |
| Name | 1,2,3,4,8,9-Hexahydrodibenz[a,h]Anthracene |
|---|---|
| Synonyms | 1,2,3,4,8,9-Hexahydrodibenz(A,J)Anthracene; Brn 2464165 |
| Molecular Structure | ![CAS#: 16310-69-3， 1,2,3,4,8,9-Hexahydrodibenz[a,h]Anthracene](/moreStructures/16310-69-3.gif) |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 16310-69-3 |
| SMILES | C1=CC2=C(C=C1)CCC3=CC5=C(C=C23)C4=C(CCCC4)C=C5 |
| InChI | 1S/C22H20/c1-3-7-19-15(5-1)9-11-17-13-18-12-10-16-6-2-4-8-20(16)22(18)14-21(17)19/h1,3,5,7,10,12-14H,2,4,6,8-9,11H2 |
| InChIKey | ZLANIZQHCMOMHT-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.927°C at 760 mmHg (Cal.) |
| Flash point | 241.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,8,9-Hexahydrodibenz[a,h]Anthracene |