|
CAS#: 16319-93-0 Product: 3-Ethoxy-17-Hydroxypregna-3,5-Dien-20-One 17-Acetate No suppilers available for the product. |
| Name | 3-Ethoxy-17-Hydroxypregna-3,5-Dien-20-One 17-Acetate |
|---|---|
| Synonyms | Acetic Acid (17-Acetyl-3-Ethoxy-10,13-Dimethyl-1,2,7,8,9,11,12,14,15,16-Decahydrocyclopenta[A]Phenanthren-17-Yl) Ester; (17-Ethanoyl-3-Ethoxy-10,13-Dimethyl-1,2,7,8,9,11,12,14,15,16-Decahydrocyclopenta[A]Phenanthren-17-Yl) Ethanoate; 3-Ethoxy-17-Hydroxypregna-3,5-Dien-20-One 17-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 |
| CAS Registry Number | 16319-93-0 |
| EINECS | 240-396-4 |
| SMILES | C(OC4=CC3=CCC2C1C(C(OC(=O)C)(CC1)C(=O)C)(CCC2C3(CC4)C)C)C |
| InChI | 1S/C25H36O4/c1-6-28-19-9-12-23(4)18(15-19)7-8-20-21(23)10-13-24(5)22(20)11-14-25(24,16(2)26)29-17(3)27/h7,15,20-22H,6,8-14H2,1-5H3 |
| InChIKey | GLUPBNAYNWZRSJ-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.864°C at 760 mmHg (Cal.) |
| Flash point | 220.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethoxy-17-Hydroxypregna-3,5-Dien-20-One 17-Acetate |