Online Database of Chemicals from Around the World
| Dr. Silviu Pharmachem Pvt. Ltd | India | Inquire | ||
|---|---|---|---|---|
 |
+91 (20) 6510-4672 | |||
 |
anil.bhise@silviupharmachem.com | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dihydro-2-Methyl-5,6-Diphenylpyrazine |
|---|---|
| Synonyms | 5-23-09-00279 (Beilstein Handbook Reference); Brn 0205957; Nsc 97036 |
| Molecular Structure |  |
| Molecular Weight | 248.33 |
| CAS Registry Number | 16340-50-4 |
| SMILES | C3=C(C1=NC(CN=C1C2=CC=CC=C2)C)C=CC=C3 |
| InChI | 1S/C17H16N2/c1-13-12-18-16(14-8-4-2-5-9-14)17(19-13)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3 |
| InChIKey | RZJRZAGATLWTMY-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.036°C at 760 mmHg (Cal.) |
| Flash point | 180.893°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-2-Methyl-5,6-Diphenylpyrazine |