Online Database of Chemicals from Around the World
|
CAS#: 16354-52-2 Product: 7,12-Diethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 7,12-Diethylbenz(a)Anthracene |
|---|---|
| Synonyms | 4-05-00-02603 (Beilstein Handbook Reference); 7,12-Diethylbenz(A)Anthracene; 7,12-Diethylbenz(Alpha)Anthracene |
| Molecular Structure |  |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 16354-52-2 |
| SMILES | C2=CC4=C(C3=C(C1=CC=CC=C1C(=C23)CC)CC)C=CC=C4 |
| InChI | 1S/C22H20/c1-3-16-19-11-7-8-12-20(19)17(4-2)22-18-10-6-5-9-15(18)13-14-21(16)22/h5-14H,3-4H2,1-2H3 |
| InChIKey | CIFPUMMYFBMFKK-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.124°C at 760 mmHg (Cal.) |
| Flash point | 238.745°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,12-Diethylbenz(a)Anthracene |