Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Ethoxy-4-Nitroindane |
|---|---|
| Synonyms | 5-ethoxy-4-nitro-2,3-dihydro-1H-indene |
| Molecular Structure |  |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 163704-79-8 |
| SMILES | O=N(=O)c1c(ccc2CCCc12)OCC |
| InChI | 1S/C11H13NO3/c1-2-15-10-7-6-8-4-3-5-9(8)11(10)12(13)14/h6-7H,2-5H2,1H3 |
| InChIKey | GJVZDWJBJUPSQD-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.257°C at 760 mmHg (Cal.) |
| Flash point | 157.168°C (Cal.) |
| Refractive index | 1.572 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethoxy-4-Nitroindane |