Online Database of Chemicals from Around the World
|
CAS#: 16398-00-8 Product: 7-Chloro-5-Phenyl-3H-1,4-Benzodiazepine No suppilers available for the product. |
| Name | 7-Chloro-5-Phenyl-3H-1,4-Benzodiazepine |
|---|---|
| Synonyms | 3H-1,4-Benzodiazepine, 7-Chloro-5-Phenyl-; 5-23-09-00207 (Beilstein Handbook Reference); Brn 0747559 |
| Molecular Structure |  |
| Molecular Formula | C15H11ClN2 |
| Molecular Weight | 254.72 |
| CAS Registry Number | 16398-00-8 |
| SMILES | C1=C(Cl)C=CC2=C1C(=NCC=N2)C3=CC=CC=C3 |
| InChI | 1S/C15H11ClN2/c16-12-6-7-14-13(10-12)15(18-9-8-17-14)11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | GIVYEEPCHMGCEK-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.034°C at 760 mmHg (Cal.) |
| Flash point | 202.386°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-5-Phenyl-3H-1,4-Benzodiazepine |