| Name | N-Allylbenzothiazolium Bromide |
|---|---|
| Synonyms | 3-Allyl-1,3-Benzothiazol-3-Ium Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10BrNS |
| Molecular Weight | 256.16 |
| CAS Registry Number | 16407-55-9 |
| SMILES | C1=CC=CC2=C1[N+](=CS2)CC=C.[Br-] |
| InChI | 1S/C10H10NS.BrH/c1-2-7-11-8-12-10-6-4-3-5-9(10)11;/h2-6,8H,1,7H2;1H/q+1;/p-1 |
| InChIKey | MEYXQRPXVJWXBZ-UHFFFAOYSA-M |
| Melting point | 150°C (Expl.) |
|---|---|
| SDS | Available |
|---|---|
| (1) | Swee Kuan Yen, Lip Lin Koh, Han Vinh Huynh and T. S. Andy Hor. Pd(ii) complexes of N,S-heterocyclic carbenes with pendant and coordinated allyl function and their Suzuki coupling activities, Dalton Trans., 2007, 0, 3952. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Allylbenzothiazolium Bromide |