Online Database of Chemicals from Around the World
|
CAS#: 16408-78-9 Product: Dicentrinone No suppilers available for the product. |
| Name | Dicentrinone |
|---|---|
| Synonyms | 8H-Benzo[G]-1,3-Benzodioxolo[6,5,4-De]Quinolin-8-One, 10,11-Dimethoxy-; Nsc617671; Oxodicentrine |
| Molecular Structure |  |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 |
| CAS Registry Number | 16408-78-9 |
| SMILES | C2=C1OCOC1=C4C3=C2C=CN=C3C(=O)C5=C4C=C(OC)C(=C5)OC |
| InChI | 1S/C19H13NO5/c1-22-12-6-10-11(7-13(12)23-2)18(21)17-15-9(3-4-20-17)5-14-19(16(10)15)25-8-24-14/h3-7H,8H2,1-2H3 |
| InChIKey | NEQVOBXBOFZEMR-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 596.711°C at 760 mmHg (Cal.) |
| Flash point | 314.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dicentrinone |