Online Database of Chemicals from Around the World
|
CAS#: 16414-49-6 Product: 2,3-Dihydroxybenzoyl-N-Glycine No suppilers available for the product. |
| Name | 2,3-Dihydroxybenzoyl-N-Glycine |
|---|---|
| Synonyms | 2-[[(2,3-Dihydroxyphenyl)-Oxomethyl]Amino]Acetic Acid; 2-[(2,3-Dihydroxyphenyl)Carbonylamino]Ethanoic Acid; 2,3-Dihydroxybenzoyl-N-Glycine |
| Molecular Structure |  |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 16414-49-6 |
| SMILES | C1=CC=C(O)C(=C1C(=O)NCC(=O)O)O |
| InChI | 1S/C9H9NO5/c11-6-3-1-2-5(8(6)14)9(15)10-4-7(12)13/h1-3,11,14H,4H2,(H,10,15)(H,12,13) |
| InChIKey | QEQVYIIYYNYLHC-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.554°C at 760 mmHg (Cal.) |
| Flash point | 251.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydroxybenzoyl-N-Glycine |