Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,1'-(2-Methyl-1,5-Pentanediyl)Bis(1H-Pyrrole-2,5-Dione) |
|---|---|
| Synonyms | 1,1'-(2-methylpentane-1,5-diyl)bis(1H-pyrrole-2,5-dione); 1,5-Bis(maleimide)-2-methyl-pentane |
| Molecular Structure |  |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 164175-55-7 |
| SMILES | O=C1\C=C/C(=O)N1CCCC(CN2C(=O)\C=C/C2=O)C |
| InChI | 1S/C14H16N2O4/c1-10(9-16-13(19)6-7-14(16)20)3-2-8-15-11(17)4-5-12(15)18/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | GQWVSMZIXHLFQM-UHFFFAOYSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.883°C at 760 mmHg (Cal.) |
| Flash point | 213.477°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(2-Methyl-1,5-Pentanediyl)Bis(1H-Pyrrole-2,5-Dione) |