| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ferric Nitrilotriacetate |
|---|---|
| Synonyms | Ferric 2-[Bis(2-Oxido-2-Oxo-Ethyl)Amino]Acetate; Ferric 2-[Bis(2-Oxido-2-Oxoethyl)Amino]Acetate; Ferric 2-[Bis(2-Keto-2-Oxido-Ethyl)Amino]Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6FeNO6 |
| Molecular Weight | 243.96 |
| CAS Registry Number | 16448-54-7 |
| SMILES | C(N(CC([O-])=O)CC([O-])=O)C([O-])=O.[Fe+3] |
| InChI | 1S/C6H9NO6.Fe/c8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);/q;+3/p-3 |
| InChIKey | FXDLIMJMHVKXAR-UHFFFAOYSA-K |
| Boiling point | 498.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 255.1°C (Cal.) |
| (1) | Otman Abida, Gilles Mailhot, Hana Mestankova, Marta Litter and Michèle Bolte. Photoinduced reduction of chromium(vi) by iron aminopolycarboxylate complex (FeNTA), Photochem. Photobiol. Sci., 2010, 9, 823. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ferric Nitrilotriacetate |