Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 5-Amino-1-(3-Nitrophenyl)-1H-Pyrazole-4-Carboxylate |
|---|---|
| Synonyms | Ethyl 5-amino-1-(3-nitrophenyl)pyrazole-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 |
| CAS Registry Number | 16459-34-0 |
| SMILES | CCOC(=O)c1cnn(c1N)c2cccc(c2)[N+](=O)[O-] |
| InChI | 1S/C12H12N4O4/c1-2-20-12(17)10-7-14-15(11(10)13)8-4-3-5-9(6-8)16(18)19/h3-7H,2,13H2,1H3 |
| InChIKey | CAQVBJANBGLDGH-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.533°C at 760 mmHg (Cal.) |
| Flash point | 229.903°C (Cal.) |
| Refractive index | 1.653 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-Amino-1-(3-Nitrophenyl)-1H-Pyrazole-4-Carboxylate |