Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-Amino-2-Benzofurancarboxylicacid Methyl Ester |
|---|---|
| Synonyms | Methyl 5-Aminobenzofuran-2-Carboxylate; 5-Amino-2-Benzofurancarboxylic Acid Methyl Ester; 5-Aminobenzofuran-2-Carboxylic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 |
| CAS Registry Number | 1646-29-3 |
| SMILES | C1=C(OC2=CC=C(N)C=C12)C(OC)=O |
| InChI | 1S/C10H9NO3/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-5H,11H2,1H3 |
| InChIKey | OLLMSIUDBMURHQ-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.066°C at 760 mmHg (Cal.) |
| Flash point | 157.652°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2-Benzofurancarboxylicacid Methyl Ester |