Online Database of Chemicals from Around the World
|
CAS#: 16473-66-8 Product: 1,1'-Methylenebis(5-L-Oxoproline) No suppilers available for the product. |
| Name | 1,1'-Methylenebis(5-L-Oxoproline) |
|---|---|
| Synonyms | 1-[(2-Carboxy-5-Oxo-Pyrrolidin-1-Yl)Methyl]-5-Oxo-Pyrrolidine-2-Carboxylic Acid; 1-[(2-Carboxy-5-Oxo-1-Pyrrolidinyl)Methyl]-5-Oxo-2-Pyrrolidinecarboxylic Acid; 1-[(2-Carboxy-5-Keto-Pyrrolidin-1-Yl)Methyl]-5-Keto-Proline |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 16473-66-8 (55780-25-1) |
| EINECS | 240-530-1 |
| SMILES | C(N1C(C(=O)O)CCC1=O)N2C(C(=O)O)CCC2=O |
| InChI | 1S/C11H14N2O6/c14-8-3-1-6(10(16)17)12(8)5-13-7(11(18)19)2-4-9(13)15/h6-7H,1-5H2,(H,16,17)(H,18,19) |
| InChIKey | XAYYGTJLXVXLMB-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 683.877°C at 760 mmHg (Cal.) |
| Flash point | 367.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Methylenebis(5-L-Oxoproline) |