Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (3S)-5,5-Dimethyl-3-(Trifluoromethyl)Oxolan-2-One |
|---|---|
| Synonyms | (3S)-5,5-Dimethyl-3-(Trifluoromethyl)Tetrahydrofuran-2-One; (3S)-5,5-Dimethyl-3-(Trifluoromethyl)-2-Tetrahydrofuranone; Zinc02569735 |
| Molecular Structure |  |
| Molecular Formula | C7H9F3O2 |
| Molecular Weight | 182.14 |
| CAS Registry Number | 164929-15-1 |
| SMILES | [C@@H]1(CC(OC1=O)(C)C)C(F)(F)F |
| InChI | 1S/C7H9F3O2/c1-6(2)3-4(5(11)12-6)7(8,9)10/h4H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | NSQKIHBAKTVICL-BYPYZUCNSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.499°C at 760 mmHg (Cal.) |
| Flash point | 67.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S)-5,5-Dimethyl-3-(Trifluoromethyl)Oxolan-2-One |