Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
|
+91 (40) 6661-1133 | |||
|
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4-(4-Nitrophenyl)Pyrimidine |
|---|---|
| Synonyms | 4-(4-nitrophenyl)pyrimidine |
| Molecular Structure |  |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.18 |
| CAS Registry Number | 16495-82-2 |
| SMILES | [O-][N+](=O)c2ccc(c1ncncc1)cc2 |
| InChI | 1S/C10H7N3O2/c14-13(15)9-3-1-8(2-4-9)10-5-6-11-7-12-10/h1-7H |
| InChIKey | YCSVBEUJTTWMGF-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.238°C at 760 mmHg (Cal.) |
| Flash point | 184.971°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Nitrophenyl)Pyrimidine |