Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(Benzoylamino)Cyclohexanecarboxylic Acid |
|---|---|
| Synonyms | (-)-cis-2-Benzamidocyclohexanecarboxylic Acid; (+)-cis-2-Benzamidocyclohexane-carboxylic acid; 2-(Benzoylamino)cyclohexanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 |
| CAS Registry Number | 16524-13-3 |
| SMILES | O=C(NC1C(C(=O)O)CCCC1)c2ccccc2 |
| InChI | 1S/C14H17NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-3,6-7,11-12H,4-5,8-9H2,(H,15,16)(H,17,18) |
| InChIKey | PUANNVQABXUYKU-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.084°C at 760 mmHg (Cal.) |
| Flash point | 259.871°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Benzoylamino)Cyclohexanecarboxylic Acid |