| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | Dnp-DL-Glutamic Acid |
| Synonyms | 2-[(2,4-Dinitrophenyl)Amino]Glutaric Acid; N-(2,4-Dinitrophenyl)-Dl-Glutamic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N3O8 |
| Molecular Weight | 313.22 |
| CAS Registry Number | 1655-48-7 |
| EINECS | 216-736-2 |
| SMILES | C1=CC(=CC(=C1NC(CCC(O)=O)C(O)=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C11H11N3O8/c15-10(16)4-3-8(11(17)18)12-7-2-1-6(13(19)20)5-9(7)14(21)22/h1-2,5,8,12H,3-4H2,(H,15,16)(H,17,18) |
| InChIKey | NZBKHTRVUNPZEN-UHFFFAOYSA-N |
| Density | 1.664g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.892°C at 760 mmHg (Cal.) |
| Flash point | 328.699°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dnp-DL-Glutamic Acid |