Online Database of Chemicals from Around the World
| Name | 1,2-Dihydro-1-Phenylnaphthalene |
|---|---|
| Synonyms | 1,2-Dihydro-1-Phenylnaphthalene; Naphthalene, 1,2-Dihydro-1-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 16606-46-5 |
| EINECS | 240-658-8 |
| SMILES | C1=CC2=C(C=C1)C(CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C16H14/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-11,16H,12H2 |
| InChIKey | MEUOGBCTOLDRCM-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.295°C at 760 mmHg (Cal.) |
| Flash point | 152.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydro-1-Phenylnaphthalene |
