Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2-Dibromo-1,3-Diphenyl-1,3-Propanedione |
|---|---|
| Synonyms | 2,2-Dibromo-1,3-diphenyl-1,3-propanedione; Dibenzoyldibromomethane |
| Molecular Structure |  |
| Molecular Formula | C15H10Br2O2 |
| Molecular Weight | 382.05 |
| CAS Registry Number | 16619-55-9 |
| SMILES | O=C(c1ccccc1)C(Br)(Br)C(=O)c2ccccc2 |
| InChI | 1S/C15H10Br2O2/c16-15(17,13(18)11-7-3-1-4-8-11)14(19)12-9-5-2-6-10-12/h1-10H |
| InChIKey | GSWSUDFFJVJMLG-UHFFFAOYSA-N |
| Density | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.228°C at 760 mmHg (Cal.) |
| Flash point | 98.493°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2-Dibromo-1,3-Diphenyl-1,3-Propanedione |