Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,9,10-Tetrahydroxyaporphine |
|---|---|
| Synonyms | 4H-Dibenzo(De,G)Quinoline-1,2,9,10-Tetrol, 5,6,6A,7-Tetrahydro-6-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 |
| CAS Registry Number | 16625-72-2 |
| EINECS | 240-676-6 |
| SMILES | C1=C(C(=C3C2=C1CCN(C2CC4=C3C=C(O)C(=C4)O)C)O)O |
| InChI | 1S/C17H17NO4/c1-18-3-2-8-5-14(21)17(22)16-10-7-13(20)12(19)6-9(10)4-11(18)15(8)16/h5-7,11,19-22H,2-4H2,1H3 |
| InChIKey | RMMKCAKVLLJONG-UHFFFAOYSA-N |
| Density | 1.478g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.431°C at 760 mmHg (Cal.) |
| Flash point | 358.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,9,10-Tetrahydroxyaporphine |