| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Ivabradine R-Enantiomer Hydrochloride |
|---|---|
| Synonyms | (-)-Ivabradine;3-[3-[[(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methyl-methylamino]propyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
| Molecular Structure | ![]() |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 |
| CAS Registry Number | 167072-91-5 |
| SMILES | CN(CCCN1CCC2=CC(=C(C=C2CC1=O)OC)OC)C[C@@H]3CC4=CC(=C(C=C34)OC)OC |
| Solubility | 0.7921 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.560, Calc.* |
| Melting point | 251.88 °C |
| Boiling Point | 584.09 °C, 626.9±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 332.9±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ivabradine R-Enantiomer Hydrochloride |