Online Database of Chemicals from Around the World
|
CAS#: 16784-10-4 Product: 4-O-[2-(Methylpropylamino)-2-Oxoethyl]Rifamycin No suppilers available for the product. |
| Name | 4-O-[2-(Methylpropylamino)-2-Oxoethyl]Rifamycin |
|---|---|
| Synonyms | Brn 5418339; Nci 143-427; Rifamycin B Methylpropylamide |
| Molecular Structure | ![CAS#: 16784-10-4， 4-O-[2-(Methylpropylamino)-2-Oxoethyl]Rifamycin](/moreStructures/16784-10-4.gif) |
| Molecular Formula | C43H58N2O13 |
| Molecular Weight | 810.94 |
| CAS Registry Number | 16784-10-4 |
| SMILES | C(OC3=CC1=C(O)C4=C(O)C(=C2OC(O\C=C\C(OC)C(C(OC(=O)C)C(C(O)C(C(O)C(\C=C\C=C(C(=O)N1)/C)C)C)C)C)(C(=O)C2=C34)C)C)C(=O)N(CCC)C |
| InChI | 1S/C43H58N2O13/c1-12-17-45(10)31(47)20-55-30-19-28-38(51)33-32(30)34-40(26(7)37(33)50)58-43(9,41(34)52)56-18-16-29(54-11)23(4)39(57-27(8)46)25(6)36(49)24(5)35(48)21(2)14-13-15-22(3)42(53)44-28/h13-16,18-19,21,23-25,29,35-36,39,48-51H,12,17,20H2,1-11H3,(H,44,53)/b14-13+,18-16+,22-15+ |
| InChIKey | RCRKUTFIUCSOQL-UCYGXLJSSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 927.401°C at 760 mmHg (Cal.) |
| Flash point | 514.674°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-O-[2-(Methylpropylamino)-2-Oxoethyl]Rifamycin |