Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,9-Dimethylpicene |
|---|---|
| Synonyms | Nsc409492; Picene, 2,9-Dimethyl-; Ccris 4028 |
| Molecular Structure |  |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 |
| CAS Registry Number | 1679-02-3 |
| EINECS | 216-840-8 |
| SMILES | C1=CC4=C(C2=C1C3=C(C=C2)C=CC(=C3)C)C=CC5=C(C=CC=C45)C |
| InChI | 1S/C24H18/c1-15-6-7-17-8-9-20-22-11-10-18-16(2)4-3-5-19(18)21(22)12-13-23(20)24(17)14-15/h3-14H,1-2H3 |
| InChIKey | NCVWVTLOKLZLJY-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.726°C at 760 mmHg (Cal.) |
| Flash point | 279.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,9-Dimethylpicene |