|
CAS#: 16803-75-1 Product: 2,2-Dibromo-N-[1,3-Dihydroxy-1-(4-Nitrophenyl)-2-Propanyl]Acetamide No suppilers available for the product. |
| Name | 2,2-Dibromo-N-[1,3-Dihydroxy-1-(4-Nitrophenyl)-2-Propanyl]Acetamide |
|---|---|
| Synonyms | 2,2-Dibro |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Br2N2O5 |
| Molecular Weight | 412.03 |
| CAS Registry Number | 16803-75-1 |
| SMILES | C1=CC(=CC=C1C(C(CO)NC(=O)C(Br)Br)O)[N+](=O)[O-] |
| InChI | 1S/C11H12Br2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18) |
| InChIKey | UWOHGNMWBGIRAQ-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.4±55.0°C at 760 mmHg (Cal.) |
| Flash point | 355.6±31.5°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dibromo-N-[1,3-Dihydroxy-1-(4-Nitrophenyl)-2-Propanyl]Acetamide |