Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 1-(2-Fluoro-4-Methoxyphenyl)Acetone |
|---|---|
| Synonyms | 1-(2-Fluoro-4-methoxyphenyl)propan-2-one; 2-FLUORO-4-METHOXYPHENYLACETONE |
| Molecular Structure |  |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 |
| CAS Registry Number | 16817-46-2 |
| SMILES | CC(=O)CC1=C(C=C(C=C1)OC)F |
| InChI | 1S/C10H11FO2/c1-7(12)5-8-3-4-9(13-2)6-10(8)11/h3-4,6H,5H2,1-2H3 |
| InChIKey | HQDQGPIMYFNCCH-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.0±25.0°C at 760 mmHg (Cal.) |
| Flash point | 95.6±18.1°C (Cal.) |
| Refractive index | 1.486 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Fluoro-4-Methoxyphenyl)Acetone |