| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-7-Iodo-Heptane |
|---|---|
| Synonyms | 1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-7-Iodo-Heptane; Heptane, 1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-7-Iodo- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4F11I |
| Molecular Weight | 424.00 |
| CAS Registry Number | 1682-31-1 |
| EINECS | 216-862-8 |
| SMILES | C(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C7H4F11I/c8-3(9,1-2-19)4(10,11)5(12,13)6(14,15)7(16,17)18/h1-2H2 |
| InChIKey | KEHJVWWDDAAVHB-UHFFFAOYSA-N |
| Density | 1.901g/cm3 (Cal.) |
|---|---|
| Boiling point | 95-96°C (Expl.) |
| 170.519°C at 760 mmHg (Cal.) | |
| Flash point | 69.597°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2,3,3,4,4,5,5-Undecafluoro-7-Iodo-Heptane |