| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N'-Benzylisonicotinohydrazide |
|---|---|
| Synonyms | 2'-(1-phenylmethyl)isonicotinohydrazide; AIDS055632; AIDS-055632 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26 |
| CAS Registry Number | 16827-11-5 |
| SMILES | C1=CC=C(C=C1)CNNC(=O)C2=CC=NC=C2 |
| InChI | 1S/C13H13N3O/c17-13(12-6-8-14-9-7-12)16-15-10-11-4-2-1-3-5-11/h1-9,15H,10H2,(H,16,17) |
| InChIKey | QFSUCTHCSKPAGJ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.6±34.0°C at 760 mmHg (Cal.) |
| Flash point | 179.1±25.7°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N'-Benzylisonicotinohydrazide |