Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | p-Bis(Epoxyethyl)Benzene |
|---|---|
| Synonyms | 2-[4-(2-Oxiranyl)Phenyl]Oxirane; P-Bis(Epoxyethyl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 16832-58-9 |
| EINECS | 240-853-8 |
| SMILES | C2=C(C1OC1)C=CC(=C2)C3OC3 |
| InChI | 1S/C10H10O2/c1-2-8(10-6-12-10)4-3-7(1)9-5-11-9/h1-4,9-10H,5-6H2 |
| InChIKey | GXZQKSKXXFOTDE-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.552°C at 760 mmHg (Cal.) |
| Flash point | 143.554°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Bis(Epoxyethyl)Benzene |