|
CAS#: 16836-31-0 Product: (5beta,9beta,10alpha,16beta)-Kaurane-16,17-Diol No suppilers available for the product. |
| Name | (5beta,9beta,10alpha,16beta)-Kaurane-16,17-Diol |
|---|---|
| Synonyms | Ent-kauran-16,17-diol; kauran-16,17-diol; Kaurane-16,17-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.48 |
| CAS Registry Number | 16836-31-0 |
| SMILES | OC[C@@]4(O)CC23[C@H]([C@@]1(CCCC([C@H]1CC2)(C)C)C)CC[C@H]4C3 |
| InChI | 1S/C20H34O2/c1-17(2)8-4-9-18(3)15(17)7-10-19-11-14(5-6-16(18)19)20(22,12-19)13-21/h14-16,21-22H,4-13H2,1-3H3/t14-,15+,16-,18+,19?,20-/m0/s1 |
| InChIKey | LCYWCTWYVKIBSA-NGMXLJMKSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.293°C at 760 mmHg (Cal.) |
| Flash point | 186.789°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5beta,9beta,10alpha,16beta)-Kaurane-16,17-Diol |